1-(4-hydroxy-3-methoxyphenyl)nonan-3-one structure
|
Common Name | 1-(4-hydroxy-3-methoxyphenyl)nonan-3-one | ||
|---|---|---|---|---|
| CAS Number | 53172-03-5 | Molecular Weight | 264.36000 | |
| Density | 1.027g/cm3 | Boiling Point | 392.8ºC at 760mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.3ºC | |
| Name | 1-(4-hydroxy-3-methoxyphenyl)nonan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.027g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760mmHg |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 137.3ºC |
| Exact Mass | 264.17300 |
| PSA | 46.53000 |
| LogP | 3.87290 |
| Index of Refraction | 1.508 |
| InChIKey | CLNNPXNIUKIPIP-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)CCc1ccc(O)c(OC)c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(4-hydroxy-3-methoxy-phenyl)-nonan-3-one |
| EINECS 258-411-8 |
| 1-(4-hydroxy-3-methoxyphenyl)-3-nonanone |