(5E)-5-(3-aminoisoindol-1-ylidene)-2-imino-1,3-thiazol-4-amine
Modify Date: 2025-09-18 09:28:19
(5E)-5-(3-aminoisoindol-1-ylidene)-2-imino-1,3-thiazol-4-amine structure
|
Common Name | (5E)-5-(3-aminoisoindol-1-ylidene)-2-imino-1,3-thiazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 53151-84-1 | Molecular Weight | 243.28800 | |
| Density | 1.75g/cm3 | Boiling Point | 413.1ºC at 760mmHg | |
| Molecular Formula | C11H9N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.6ºC | |
| Name | (5E)-5-(3-aminoisoindol-1-ylidene)-2-imino-1,3-thiazol-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 413.1ºC at 760mmHg |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.28800 |
| Flash Point | 203.6ºC |
| Exact Mass | 243.05800 |
| PSA | 120.91000 |
| LogP | 2.48900 |
| Index of Refraction | 1.916 |
| InChIKey | DQPSHNYDEMTVTC-UHFFFAOYSA-N |
| SMILES | N=C1N=C(c2sc(N)nc2N)c2ccccc21 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-imino-3-(2,4-diimino-5-thiazolidinylidene)-isoindoline |
| 1H-Isoindol-3-amine,1-(2-amino-4-imino-5(4H)-thiazolylidene) |
| 1-(2-Amino-4-imino-5(4H)-thiazolylidene)-1H-isoindol-3-amine |
| 1-(2-Amino-4-imino-(4H)-thiazol-5-ylidene)-1H-isoindol-3-amine |