2,5-bis(trifluoromethyl)benzamide structure
|
Common Name | 2,5-bis(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 53130-46-4 | Molecular Weight | 257.13300 | |
| Density | 1.468g/cm3 | Boiling Point | 222.1ºC at 760 mmHg | |
| Molecular Formula | C9H5F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.1ºC | |
| Name | 2,5-bis(trifluoromethyl)benzamide |
|---|
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 222.1ºC at 760 mmHg |
| Molecular Formula | C9H5F6NO |
| Molecular Weight | 257.13300 |
| Flash Point | 88.1ºC |
| Exact Mass | 257.02800 |
| PSA | 43.09000 |
| LogP | 3.52340 |
| Index of Refraction | 1.428 |
| InChIKey | OYXFWPXMRHRCTB-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |