(6,7-Dichloro-2,2-dimethyl-1-oxoindan-5-yl)oxyacetic acid
Modify Date: 2025-09-14 11:39:56
(6,7-Dichloro-2,2-dimethyl-1-oxoindan-5-yl)oxyacetic acid structure
|
Common Name | (6,7-Dichloro-2,2-dimethyl-1-oxoindan-5-yl)oxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 53107-41-8 | Molecular Weight | 303.13800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(6,7-dichloro-2,2-dimethyl-1-oxo-3H-inden-5-yl)oxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12Cl2O4 |
|---|---|
| Molecular Weight | 303.13800 |
| Exact Mass | 302.01100 |
| PSA | 63.60000 |
| LogP | 3.22180 |
| InChIKey | MGJRWQJNPCGVRH-UHFFFAOYSA-N |
| SMILES | CC1(C)Cc2cc(OCC(=O)O)c(Cl)c(Cl)c2C1=O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ACETIC ACID,6,7-DICHLORO-2,2-DIMETHYL-1-OXO-5-INDANYLOXY |
| 6,7-Dichloro-2,2-dimethyl-1-oxo-5-indanyloxyacetic acid |