Caproxamine
Modify Date: 2025-08-25 09:59:59
Caproxamine structure
|
Common Name | Caproxamine | ||
|---|---|---|---|---|
| CAS Number | 53078-44-7 | Molecular Weight | 263.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Caproxamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H25N3O |
|---|---|
| Molecular Weight | 263.37800 |
| Exact Mass | 263.20000 |
| PSA | 73.63000 |
| LogP | 4.11840 |
| InChIKey | ZIWQJHATUBOOFD-OBGWFSINSA-N |
| SMILES | CCCCCC(=NOCCN)c1ccc(C)c(N)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (E)-1-(3-Amino-4-methylphenyl)-1-hexanone O-(2-aminoethyl)oxime |