N-[(E)-[2-(4-cyclohexylsulfanylphenyl)-2-oxoethylidene]amino]pyridine-4-carboxamide
Modify Date: 2025-10-01 20:08:22
![N-[(E)-[2-(4-cyclohexylsulfanylphenyl)-2-oxoethylidene]amino]pyridine-4-carboxamide Structure](https://image.chemsrc.com/caspic/436/53066-96-9.png)
N-[(E)-[2-(4-cyclohexylsulfanylphenyl)-2-oxoethylidene]amino]pyridine-4-carboxamide structure
|
Common Name | N-[(E)-[2-(4-cyclohexylsulfanylphenyl)-2-oxoethylidene]amino]pyridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 53066-96-9 | Molecular Weight | 367.46500 | |
| Density | 1.258g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H21N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-[2-(4-cyclohexylsulfanylphenyl)-2-oxoethylidene]amino]pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.46500 |
| Exact Mass | 367.13500 |
| PSA | 96.72000 |
| LogP | 4.49580 |
| Index of Refraction | 1.644 |
| InChIKey | RNENPASAJDURAX-HYARGMPZSA-N |
| SMILES | O=C(C=NNC(=O)c1ccncc1)c1ccc(SC2CCCCC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-cyclohexylsulfanyl-phenyl)-oxo-acetaldehyde isonicotinoylhydrazone |
| 4-Pyridinecarboxylic acid,(2-(4-(cyclohexylthio)phenyl)-2-oxoethylidine)hydrazide |
| 4-Cyclohexylthiophenylglyoxal-isonicotinyl-hydrazon |
| (4-Cyclohexylthio)phenylglyoxal isonicotinylhydrazone |