4'-Nitro-3-biphenylamine
Modify Date: 2025-08-27 22:55:19
4'-Nitro-3-biphenylamine structure
|
Common Name | 4'-Nitro-3-biphenylamine | ||
|---|---|---|---|---|
| CAS Number | 53059-29-3 | Molecular Weight | 214.22000 | |
| Density | 1.268g/cm3 | Boiling Point | 422.2ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.2ºC | |
| Name | 3-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760 mmHg |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 209.2ºC |
| Exact Mass | 214.07400 |
| PSA | 71.84000 |
| LogP | 3.94840 |
| Index of Refraction | 1.65 |
| InChIKey | IOKXTTPVYZCVCV-UHFFFAOYSA-N |
| SMILES | Nc1cccc(-c2ccc([N+](=O)[O-])cc2)c1 |
| HS Code | 2921499090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:62-23-7| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4'-nitro-biphenyl-3-ylamine |
| 4'-Nitro-3-biphenylamine |
| 3-BIPHENYLAMINE,4'-NITRO |
| 3-Amino-4'-nitrobiphenyl |
| 4'-Nitro-biphenyl-3-ylamin |
| 4'-Nitro-3-aminobiphenyl |
| 4'-nitro-(1,1'-biphenyl)-3-amine |
| 4'-Nitro-3-amino-diphenyl |