2-chloro-N-(2-ethylsulfanylethyl)phenothiazine-10-carboxamide
Modify Date: 2024-09-08 16:56:44
2-chloro-N-(2-ethylsulfanylethyl)phenothiazine-10-carboxamide structure
|
Common Name | 2-chloro-N-(2-ethylsulfanylethyl)phenothiazine-10-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 53056-63-6 | Molecular Weight | 364.91300 | |
| Density | 1.34g/cm3 | Boiling Point | 581.3ºC at 760 mmHg | |
| Molecular Formula | C17H17ClN2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.3ºC | |
| Name | 2-chloro-N-(2-ethylsulfanylethyl)phenothiazine-10-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 581.3ºC at 760 mmHg |
| Molecular Formula | C17H17ClN2OS2 |
| Molecular Weight | 364.91300 |
| Flash Point | 305.3ºC |
| Exact Mass | 364.04700 |
| PSA | 86.43000 |
| LogP | 5.67480 |
| Index of Refraction | 1.66 |
| InChIKey | BIWXMBLBCUBBGR-UHFFFAOYSA-N |
| SMILES | CCSCCNC(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-phenothiazine-10-carboxylic acid 2-ethylsulfanyl-ethylamide |
| N-(2-Ethylmercaptoethyl)-2-chlorphenothiazin-10-carboxamid |
| 10H-Phenothiazine-10-carboxamide,2-chloro-N-(2-(ethylthio)ethyl) |
| 2-Chloro-N-(2-(ethylthio)ethyl)-10H-phenothiazine-10-carboxamide |