ibuterol
Modify Date: 2025-08-25 10:14:02
ibuterol structure
|
Common Name | ibuterol | ||
|---|---|---|---|---|
| CAS Number | 53034-85-8 | Molecular Weight | 365.46400 | |
| Density | 1.083g/cm3 | Boiling Point | 478.4ºC at 760mmHg | |
| Molecular Formula | C20H31NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | ibuterol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 478.4ºC at 760mmHg |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.46400 |
| Flash Point | 243.2ºC |
| Exact Mass | 365.22000 |
| PSA | 84.86000 |
| LogP | 3.62180 |
| Index of Refraction | 1.507 |
| InChIKey | WKHOPHIMYDJVSA-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)Oc1cc(OC(=O)C(C)C)cc(C(O)CNC(C)(C)C)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(3',5'-diisobutyryloxyphenyl)-2-(tert.-butylamino)ethanol |
| 1-(3,5-dihydroxyphenyl)-2-(tert-butylamino)ethanol diisobutyrate ester |
| 5-[2-(tert-Butylamino)-1-hydroxyethyl]-m-phenylenebis(2-methylpropanoate) |