3-ethyl-2-methylnaphtho[2,1-d]thiazolium toluene-p-sulphonate structure
|
Common Name | 3-ethyl-2-methylnaphtho[2,1-d]thiazolium toluene-p-sulphonate | ||
|---|---|---|---|---|
| CAS Number | 53019-76-4 | Molecular Weight | 399.52600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium,4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H21NO3S2 |
|---|---|
| Molecular Weight | 399.52600 |
| Exact Mass | 399.09600 |
| PSA | 97.70000 |
| LogP | 5.65020 |
| InChIKey | ZHJSCTBAIQQVLN-UHFFFAOYSA-M |
| SMILES | CC[n+]1c(C)sc2c3ccccc3ccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| HS Code | 2934999090 |
|---|
|
~%
3-ethyl-2-methy... CAS#:53019-76-4 |
| Literature: Brooker; White Journal of the American Chemical Society, 1935 , vol. 57, p. 547,550 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethyl-2-methylnaphtho[2,1-d]thiazolium toluene-p-sulfonate |
| 3-Ethyl-2-methylnaphtho(2,1-d)thiazolium toluene-p-sulphonate |
| EINECS 258-300-4 |
| T0400-2692 |
| 3-ethyl-2-methyl-naphtho[2,1-d]thiazolium tosylate |
| 3-ethyl-2-methyl-naphtho[2,1-d]thiazolium,toluene-4-sulfonate |
| 3-Aethyl-2-methyl-naphtho[2,1-d]thiazolium,Toluol-4-sulfonat |
| 2-methyl-3-ethyl-6,7-benzobenzothiazolium p-toluenesulfonate |