N-[1-(4-bromophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide
Modify Date: 2025-09-19 11:30:56
![N-[1-(4-bromophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide Structure](https://image.chemsrc.com/caspic/078/5301-90-6.png)
N-[1-(4-bromophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide structure
|
Common Name | N-[1-(4-bromophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 5301-90-6 | Molecular Weight | 485.75800 | |
| Density | 1.48g/cm3 | Boiling Point | 727.5ºC at 760 mmHg | |
| Molecular Formula | C23H18BrClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.8ºC | |
| Name | N-[1-(4-bromophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 727.5ºC at 760 mmHg |
| Molecular Formula | C23H18BrClN2O3 |
| Molecular Weight | 485.75800 |
| Flash Point | 393.8ºC |
| Exact Mass | 484.01900 |
| PSA | 74.41000 |
| LogP | 6.74500 |
| Index of Refraction | 1.677 |
| InChIKey | VDJWBROIPJHOBR-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)C(=Cc2ccc(Br)cc2)NC(=O)c2ccccc2Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Acetoxymethyl-1,2-diphenyl-urazol |
| N-[(Z)-2-(4-BROMOPHENYL)-1-[(4-METHOXYPHENYL)CARBAMOYL]VINYL]-2-CHLORO-BENZAMIDE |
| 4-acetoxymethyl-1,2-diphenyl-[1,2,4]triazolidine-3,5-dione |
| N-{(1Z)-1-(4-bromophenyl)-3-[(4-methoxyphenyl)amino]-3-oxoprop-1-en-2-yl}-2-chlorobenzamide |