2-(1-Methylpropyl)-4,6-dinitrophenol structure
|
Common Name | 2-(1-Methylpropyl)-4,6-dinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 530-17-6 | Molecular Weight | 240.21300 | |
| Density | 1.351g/cm3 | Boiling Point | 362.6ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.8ºC | |
| Name | 2-(2-methylpropyl)-4,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 362.6ºC at 760 mmHg |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21300 |
| Flash Point | 153.8ºC |
| Exact Mass | 240.07500 |
| PSA | 111.87000 |
| LogP | 3.45350 |
| Index of Refraction | 1.59 |
| InChIKey | ZCUZYXAJTZQRHO-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| HS Code | 2908999090 |
|---|
|
~%
2-(1-Methylprop... CAS#:530-17-6 |
| Literature: Veader; Leonard Patent: US2048168 , 1935 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3.5-dinitro-2-hydroxy-1-isobutyl-benzene |
| 2-sec-butyl-4,6-dinitrophenol |
| i-Dinoseb |
| 3.5-Dinitro-2-hydroxy-1-isobutyl-benzol |
| 2-(2-methylpropyl)-4,6-dinitro-phenol |
| 2,4-dinitro-6-iso-butylphenol |
| 2-s-butyl-4,6-dinitrophenol |
| 2-i-Butyl-4,6-dinitrophenol |