2,3-diphenyl-1H-indene-1-carboxylic acid structure
|
Common Name | 2,3-diphenyl-1H-indene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 52986-48-8 | Molecular Weight | 312.36100 | |
| Density | 1.257g/cm3 | Boiling Point | 496.2ºC at 760 mmHg | |
| Molecular Formula | C22H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8ºC | |
| Name | 2,3-diphenyl-1H-indene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 496.2ºC at 760 mmHg |
| Molecular Formula | C22H16O2 |
| Molecular Weight | 312.36100 |
| Flash Point | 225.8ºC |
| Exact Mass | 312.11500 |
| PSA | 37.30000 |
| LogP | 4.82750 |
| Index of Refraction | 1.672 |
| InChIKey | SXWYRDLDEIGGJD-UHFFFAOYSA-N |
| SMILES | O=C(O)C1C(c2ccccc2)=C(c2ccccc2)c2ccccc21 |
|
~%
2,3-diphenyl-1H... CAS#:52986-48-8 |
| Literature: Pettit,W.A.; Wilson,J.W. Journal of the American Chemical Society, 1977 , vol. 99, # 19 p. 6372 - 6379 |
|
~%
2,3-diphenyl-1H... CAS#:52986-48-8 |
| Literature: Pettit,W.A.; Wilson,J.W. Journal of the American Chemical Society, 1977 , vol. 99, # 19 p. 6372 - 6379 |
| 2,3-Diphenylinden-1-carbonsaeure |