ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate
![ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate Structure](https://image.chemsrc.com/caspic/303/52980-54-8.png)
ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate structure
|
Common Name | ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 52980-54-8 | Molecular Weight | 283.19400 | |
| Density | 1.65g/cm3 | Boiling Point | 386.9ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 386.9ºC at 760 mmHg |
| Molecular Formula | C10H9N3O7 |
| Molecular Weight | 283.19400 |
| Flash Point | 187.8ºC |
| Exact Mass | 283.04400 |
| PSA | 133.29000 |
| LogP | 1.09080 |
| Index of Refraction | 1.645 |
| InChIKey | CPLLQPUCYJDKLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1nc(-c2ccc([N+](=O)[O-])o2)oc1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 2-[5-(5-n... CAS#:52980-54-8 |
| Literature: Akerblom Journal of Medicinal Chemistry, 1974 , vol. 17, # 7 p. 756 - 758 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: Polar surface area (PSA) of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is 133.29000. |
| Q: What are the upstream materials of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: Related upstream materials(CAS) of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate: 105-36-2;2122-86-3. |
| Q: What is the molecular formula of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: Molecular formula of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is C10H9N3O7. |
| Q: What is the SMILES notation of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: SMILES notation of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is CCOC(=O)Cn1nc(-c2ccc([N+](=O)[O-])o2)oc1=O. |
| Q: What is the Chinese name of 52980-54-8? |
| A: Chinese name of 52980-54-8 is 52980-54-8. |
| Q: What is the LogP of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: LogP of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is 1.09080. |
| Q: What is the InChIKey of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: InChIKey of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is CPLLQPUCYJDKLL-UHFFFAOYSA-N. |
| Q: What is the boiling point of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: Boiling point of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is 386.9ºC at 760 mmHg. |
| Q: What is the English name of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: The English name of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate. |
| Q: What is the molecular weight of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate? |
| A: Molecular weight of ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate is 283.19400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |