1,4-dimethyl-2-nitroimidazole structure
|
Common Name | 1,4-dimethyl-2-nitroimidazole | ||
|---|---|---|---|---|
| CAS Number | 5297-92-7 | Molecular Weight | 141.12800 | |
| Density | 1.36g/cm3 | Boiling Point | 317.2ºC at 760 mmHg | |
| Molecular Formula | C5H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.6ºC | |
| Name | 1,4-dimethyl-2-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 317.2ºC at 760 mmHg |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.12800 |
| Flash Point | 145.6ºC |
| Exact Mass | 141.05400 |
| PSA | 63.64000 |
| LogP | 1.15990 |
| Index of Refraction | 1.598 |
| InChIKey | ISFBTZLEOKKUDX-UHFFFAOYSA-N |
| SMILES | Cc1cn(C)c([N+](=O)[O-])n1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-Dimethyl-2-nitro-1H-imidazole |
| 1,4-Dimethyl-2-nitro-imidazol |
| Imidazole,1,4-dimethyl-2-nitro |