N-(2,4-dinitrophenyl)methanesulfonamide structure
|
Common Name | N-(2,4-dinitrophenyl)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 52960-15-3 | Molecular Weight | 261.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-dinitrophenyl)methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7N3O6S |
|---|---|
| Molecular Weight | 261.21200 |
| Exact Mass | 261.00600 |
| PSA | 146.19000 |
| LogP | 3.07470 |
| InChIKey | CXMFPAXYFLFBHT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
N-(2,4-dinitrop... CAS#:52960-15-3 |
| Literature: Shriner; Goebel; Marvel Journal of the American Chemical Society, 1932 , vol. 54, p. 2470,2473 |
|
~%
N-(2,4-dinitrop... CAS#:52960-15-3 |
| Literature: Shriner; Goebel; Marvel Journal of the American Chemical Society, 1932 , vol. 54, p. 2470,2473 |
|
~%
N-(2,4-dinitrop... CAS#:52960-15-3 |
| Literature: Shriner; Goebel; Marvel Journal of the American Chemical Society, 1932 , vol. 54, p. 2470,2473 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| N-(2,4-Dinitro)methansulfonanilid |
| Methansulfonsaeure-(2,4-dinitro-anilid) |
| 2',4'-Dinitromethanesulfonanilide |
| Methanesulfonamide,N-(2,4-dinitrophenyl) |
| methanesulfonic acid-(2,4-dinitro-anilide) |