1-diethylamino-3-(2-methylphenoxy)propan-2-ol structure
|
Common Name | 1-diethylamino-3-(2-methylphenoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 5296-10-6 | Molecular Weight | 273.79900 | |
| Density | 1.014g/cm3 | Boiling Point | 361.5ºC at 760 mmHg | |
| Molecular Formula | C14H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.4ºC | |
| Name | 1-(diethylamino)-3-(2-methylphenoxy)propan-2-ol,hydrochloride |
|---|
| Density | 1.014g/cm3 |
|---|---|
| Boiling Point | 361.5ºC at 760 mmHg |
| Molecular Formula | C14H24ClNO2 |
| Molecular Weight | 273.79900 |
| Flash Point | 172.4ºC |
| Exact Mass | 273.15000 |
| PSA | 32.70000 |
| LogP | 2.87850 |
| Index of Refraction | 1.517 |
| InChIKey | RXALYLXMGHCLFD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(O)COc1ccccc1C.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |