Beloranib hemioxalate
Modify Date: 2025-12-13 18:11:48
Beloranib hemioxalate structure
|
Common Name | Beloranib hemioxalate | ||
|---|---|---|---|---|
| CAS Number | 529511-79-3 | Molecular Weight | 589.67400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H43NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Beloranib hemioxalateAn analog of the natural compound Fumagillin that functions as a highly potent methionine aminopeptidase 2 (MetAP2) inhibitor. |
| Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoate,oxalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H43NO10 |
|---|---|
| Molecular Weight | 589.67400 |
| Exact Mass | 589.28900 |
| PSA | 147.66000 |
| LogP | 3.41540 |
| InChIKey | OBFUDFUBQNPMRQ-FTIILNKYSA-N |
| SMILES | COC1C(OC(=O)C=Cc2ccc(OCCN(C)C)cc2)CCC2(CO2)C1C1(C)OC1CC=C(C)C.O=C(O)C(=O)O |
| CKD 732 |
| Beloranib hemioxalate |