2-Amino-5-fluoroterephthalicaciddimethylester
Modify Date: 2025-08-25 19:13:01
2-Amino-5-fluoroterephthalicaciddimethylester structure
|
Common Name | 2-Amino-5-fluoroterephthalicaciddimethylester | ||
|---|---|---|---|---|
| CAS Number | 5292-49-9 | Molecular Weight | 227.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dimethyl 2-amino-5-fluoroterephthalate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10FNO4 |
|---|---|
| Molecular Weight | 227.18900 |
| Exact Mass | 227.05900 |
| PSA | 78.62000 |
| LogP | 1.56230 |
| InChIKey | SLSUGUALRLSDPF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(F)c(C(=O)OC)cc1N |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-amino-5-chloroterephthalic acid dimethyl ester |
| 2-Amino-5-fluor-terephthalsaeure-dimethylester |
| Dimethyl 2-amino-5-chloroterephthalate |
| 2-Amino-5-chlorterephthalsaeuredimethylester |
| dimethyl 2-amino-5-chloro-1,4-benzenedicarboxylate |
| 2-amino-5-fluoro-terephthalic acid dimethyl ester |
| dimethyl 2-amino-5-fluoro-1,4-benzenedicarboxylate |