N-[1-(9-Ethyl-9H-carbazol-3-yl)ethyl]formamide structure
|
Common Name | N-[1-(9-Ethyl-9H-carbazol-3-yl)ethyl]formamide | ||
|---|---|---|---|---|
| CAS Number | 52916-24-2 | Molecular Weight | 266.33800 | |
| Density | 1.14g/cm3 | Boiling Point | 452.1ºC at 760 mmHg | |
| Molecular Formula | C17H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.2ºC | |
| Name | N-[1-(9-ethylcarbazol-3-yl)ethyl]formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 452.1ºC at 760 mmHg |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.33800 |
| Flash Point | 227.2ºC |
| Exact Mass | 266.14200 |
| PSA | 37.52000 |
| LogP | 4.46170 |
| Index of Refraction | 1.613 |
| InChIKey | YUCFQWHWDZHHFY-UHFFFAOYSA-N |
| SMILES | CCn1c2ccccc2c2cc(C(C)NC=O)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbazole,9-ethyl-3-(1-(formylamino)ethyl) |
| FORMAMIDE,N-(1-(9-ETHYLCARBAZOL-3-YL)ETHYL) |
| 9-Ethyl-3-(1-(formylamino)ethyl)carbazole |
| N-[1-(9-ethyl-carbazol-3-yl)-ethyl]-formamide |