1-(4-fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one,N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide structure
|
Common Name | 1-(4-fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one,N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 52869-98-4 | Molecular Weight | 692.90400 | |
| Density | N/A | Boiling Point | 511.8ºC at 760 mmHg | |
| Molecular Formula | C43H53FN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | 1-(4-fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one,N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 511.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C43H53FN4O3 |
| Molecular Weight | 692.90400 |
| Flash Point | 263.3ºC |
| Exact Mass | 692.41000 |
| PSA | 56.33000 |
| LogP | 7.69690 |
| InChIKey | ZGSCXZXNQAFLDL-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1.COc1ccccc1N1CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| N-(1-phenethyl-4-piperidyl)-N-phenyl-propanamide |
| Fentanyl mixture with fluanisone |
| N-Phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide mixt. with 1-(4-fluorophenyl)-4-(4-(2-methoxyphenyl)-1-piperazinyl)-1-butanone |
| N-(1-phenethylpiperidin-4-yl)-N-phenylpropanamide |