4-chloro-6-methoxy-5-nitro-pyrimidine structure
|
Common Name | 4-chloro-6-methoxy-5-nitro-pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 52854-14-5 | Molecular Weight | 189.55700 | |
| Density | 1.532g/cm3 | Boiling Point | 343.1ºC at 760 mmHg | |
| Molecular Formula | C5H4ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.3ºC | |
| Name | 4-chloro-6-methoxy-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 343.1ºC at 760 mmHg |
| Molecular Formula | C5H4ClN3O3 |
| Molecular Weight | 189.55700 |
| Flash Point | 161.3ºC |
| Exact Mass | 188.99400 |
| PSA | 80.83000 |
| LogP | 1.57000 |
| Index of Refraction | 1.569 |
| InChIKey | YZTJXHWQWCLEJX-UHFFFAOYSA-N |
| SMILES | COc1ncnc(Cl)c1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
|
~71%
4-chloro-6-meth... CAS#:52854-14-5 |
| Literature: MERCK SHARP and DOHME LIMITED Patent: WO2004/41826 A1, 2004 ; Location in patent: Page 42 ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-6-methoxy-4-chloropyrimidine |
| 4-Chloro-6-methoxy-5-nitro-pyrimidine |
| 5-nitro-4-chloro-6-methoxypyrimidine |
| 4-methoxy-6-chloro-5-nitropyrimidine |
| 4-Chlor-5-nitro-6-methoxy-pyrimidin |
| 4-methoxy-5-nitro-6-chloropyrimidine |