N-(4-bromo-2-propan-2-ylphenyl)-2-(4-ethylphenoxy)acetamide
Modify Date: 2025-08-23 15:17:41
N-(4-bromo-2-propan-2-ylphenyl)-2-(4-ethylphenoxy)acetamide structure
|
Common Name | N-(4-bromo-2-propan-2-ylphenyl)-2-(4-ethylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 528531-90-0 | Molecular Weight | 376.28700 | |
| Density | 1.297g/cm3 | Boiling Point | 516.3ºC at 760 mmHg | |
| Molecular Formula | C19H22BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266ºC | |
| Name | N-(4-bromo-2-propan-2-ylphenyl)-2-(4-ethylphenoxy)acetamide |
|---|
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 516.3ºC at 760 mmHg |
| Molecular Formula | C19H22BrNO2 |
| Molecular Weight | 376.28700 |
| Flash Point | 266ºC |
| Exact Mass | 375.08300 |
| PSA | 38.33000 |
| LogP | 5.22540 |
| Index of Refraction | 1.592 |
| InChIKey | XMFFXPRPJJNORP-UHFFFAOYSA-N |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc(Br)cc2C(C)C)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |