2-(3-hydroxypropyl)-6-[(3-hydroxypropyl)amino]-1H-benz[de]isoquinoline-1,3(2H)-dione structure
|
Common Name | 2-(3-hydroxypropyl)-6-[(3-hydroxypropyl)amino]-1H-benz[de]isoquinoline-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 52821-24-6 | Molecular Weight | 328.36200 | |
| Density | 1.378g/cm3 | Boiling Point | 617.4ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.2ºC | |
| Name | 2-(3-hydroxypropyl)-6-(3-hydroxypropylamino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 617.4ºC at 760 mmHg |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.36200 |
| Flash Point | 327.2ºC |
| Exact Mass | 328.14200 |
| PSA | 91.56000 |
| LogP | 1.20240 |
| Index of Refraction | 1.693 |
| InChIKey | WPQGAQRPOWJJGT-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc3c(NCCCO)ccc(c23)C(=O)N1CCCO |
|
~72%
2-(3-hydroxypro... CAS#:52821-24-6 |
| Literature: Yuan, Dongwu; Brown, Robert G.; Hepworth, John D.; Alexiou, Michael S.; Tyman, John H. P. Journal of Heterocyclic Chemistry, 2008 , vol. 45, # 2 p. 397 - 404 |
|
~71%
2-(3-hydroxypro... CAS#:52821-24-6 |
| Literature: Minakova; Bedrik; Shershukov; Surov; Pivnenko Chemistry of Heterocyclic Compounds, 1999 , vol. 35, # 5 p. 621 - 624 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(3-Hydroxypropylamino)-naphthal(3-hydroxypropyl)imide |
| 2-(3-Hydroxypropyl)-6-((3-hydroxypropyl)amino)-1H-benz(de)isoquinoline-1,3(2H)-dione |
| 1H-Benz(de)isoquinoline-1,3(2H)-dione,2-(3-hydroxypropyl)-6-((3-hydroxypropyl)amino) |
| EINECS 258-203-7 |