N-(3-bromo-4-chlorophenyl)-2-(4-ethylphenoxy)acetamide
Modify Date: 2025-08-25 19:17:06
N-(3-bromo-4-chlorophenyl)-2-(4-ethylphenoxy)acetamide structure
|
Common Name | N-(3-bromo-4-chlorophenyl)-2-(4-ethylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 527746-29-8 | Molecular Weight | 368.65300 | |
| Density | 1.463g/cm3 | Boiling Point | 525.1ºC at 760 mmHg | |
| Molecular Formula | C16H15BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.3ºC | |
| Name | N-(3-bromo-4-chlorophenyl)-2-(4-ethylphenoxy)acetamide |
|---|
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 525.1ºC at 760 mmHg |
| Molecular Formula | C16H15BrClNO2 |
| Molecular Weight | 368.65300 |
| Flash Point | 271.3ºC |
| Exact Mass | 366.99700 |
| PSA | 38.33000 |
| LogP | 4.75540 |
| Index of Refraction | 1.623 |
| InChIKey | NNFFSCHJSNMZKN-UHFFFAOYSA-N |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc(Cl)c(Br)c2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |