(2S)-2-amino-3-hydroxy-3-(2-nitrophenyl)propanoic acid
Modify Date: 2025-09-15 18:42:30
(2S)-2-amino-3-hydroxy-3-(2-nitrophenyl)propanoic acid structure
|
Common Name | (2S)-2-amino-3-hydroxy-3-(2-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 52773-86-1 | Molecular Weight | 226.18600 | |
| Density | 1.533g/cm3 | Boiling Point | 518.1ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.1ºC | |
| Name | (2S)-2-amino-3-hydroxy-3-(2-nitrophenyl)propanoic acid |
|---|
| Density | 1.533g/cm3 |
|---|---|
| Boiling Point | 518.1ºC at 760 mmHg |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.18600 |
| Flash Point | 267.1ºC |
| Exact Mass | 226.05900 |
| PSA | 129.37000 |
| LogP | 1.26360 |
| Index of Refraction | 1.646 |
| InChIKey | HICBGALJKFSUJH-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)C(O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |