2-(2-morpholin-4-yldiazenylphenyl)quinazolin-4-amine structure
|
Common Name | 2-(2-morpholin-4-yldiazenylphenyl)quinazolin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 52768-16-8 | Molecular Weight | 334.37500 | |
| Density | 1.38g/cm3 | Boiling Point | 485.4ºC at 760 mmHg | |
| Molecular Formula | C18H18N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.4ºC | |
| Name | 2-[2-(morpholin-4-yldiazenyl)phenyl]quinazolin-4-amine |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 485.4ºC at 760 mmHg |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.37500 |
| Flash Point | 247.4ºC |
| Exact Mass | 334.15400 |
| PSA | 88.99000 |
| LogP | 3.72900 |
| Index of Refraction | 1.715 |
| InChIKey | AZVQWYKOYKDBHX-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2N=NN2CCOCC2)nc2ccccc12 |
|
~%
2-(2-morpholin-... CAS#:52768-16-8 |
| Literature: Stevens,M.F.G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1974 , p. 615 - 620 |
|
~%
2-(2-morpholin-... CAS#:52768-16-8 |
| Literature: Stevens,M.F.G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1974 , p. 615 - 620 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |