Phenylphosphinic acid phenyl ester structure
|
Common Name | Phenylphosphinic acid phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 52744-21-5 | Molecular Weight | 217.18000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O2P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | oxo-phenoxy-phenylphosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10O2P+ |
|---|---|
| Molecular Weight | 217.18000 |
| Exact Mass | 217.04200 |
| PSA | 60.44000 |
| LogP | 3.13330 |
| InChIKey | LEGSDIBWTVJPPR-UHFFFAOYSA-N |
| SMILES | O=[P+](Oc1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~97%
Phenylphosphini... CAS#:52744-21-5 |
| Literature: Dumond, Yves R.; Baker, Rhonda L.; Montchamp, Jean-Luc Organic Letters, 2000 , vol. 2, # 21 p. 3341 - 3344 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphinic acid,phenyl-,phenyl ester |
| Phenylphosphinic acid phenyl ester |