3,4,5-tris[(4-fluorophenyl)methylsulfanyl]pyridazine structure
|
Common Name | 3,4,5-tris[(4-fluorophenyl)methylsulfanyl]pyridazine | ||
|---|---|---|---|---|
| CAS Number | 5273-28-9 | Molecular Weight | 500.62200 | |
| Density | 1.39g/cm3 | Boiling Point | 625.1ºC at 760 mmHg | |
| Molecular Formula | C25H19F3N2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.9ºC | |
| Name | 3,4,5-tris[(4-fluorophenyl)methylsulfanyl]pyridazine |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 625.1ºC at 760 mmHg |
| Molecular Formula | C25H19F3N2S3 |
| Molecular Weight | 500.62200 |
| Flash Point | 331.9ºC |
| Exact Mass | 500.06600 |
| PSA | 101.68000 |
| LogP | 7.77080 |
| Index of Refraction | 1.676 |
| InChIKey | DMOZVRJLKUYZBR-UHFFFAOYSA-N |
| SMILES | Fc1ccc(CSc2cnnc(SCc3ccc(F)cc3)c2SCc2ccc(F)cc2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |