4(4-chlorophenyl)-1-(4-(4-fluorophenyl)-4-oxobutyl)-1,2,3,6-tetrahydropyridine hydrochloride structure
|
Common Name | 4(4-chlorophenyl)-1-(4-(4-fluorophenyl)-4-oxobutyl)-1,2,3,6-tetrahydropyridine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 52669-92-8 | Molecular Weight | 357.84900 | |
| Density | 1.196g/cm3 | Boiling Point | 496.8ºC at 760mmHg | |
| Molecular Formula | C21H21ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.3ºC | |
| Name | 4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 496.8ºC at 760mmHg |
| Molecular Formula | C21H21ClFNO |
| Molecular Weight | 357.84900 |
| Flash Point | 254.3ºC |
| Exact Mass | 357.13000 |
| PSA | 20.31000 |
| LogP | 5.16920 |
| Index of Refraction | 1.576 |
| InChIKey | ZNOLNAPJKOYTHY-UHFFFAOYSA-N |
| SMILES | O=C(CCCN1CC=C(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Clp-FP-OB-thp |