2,2',3,3',4,5,5'-Heptachlorobiphenyl
Modify Date: 2025-09-14 01:32:15
2,2',3,3',4,5,5'-Heptachlorobiphenyl structure
|
Common Name | 2,2',3,3',4,5,5'-Heptachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 52663-74-8 | Molecular Weight | 395.32300 | |
| Density | 1.658g/cm3 | Boiling Point | 427.2ºC at 760mmHg | |
| Molecular Formula | C12H3Cl7 | Melting Point | 131.31°C (estimate) | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | 2,2',3,3',4,5,5'-Heptachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.658g/cm3 |
|---|---|
| Boiling Point | 427.2ºC at 760mmHg |
| Melting Point | 131.31°C (estimate) |
| Molecular Formula | C12H3Cl7 |
| Molecular Weight | 395.32300 |
| Flash Point | 213ºC |
| Exact Mass | 391.80500 |
| LogP | 7.92740 |
| Index of Refraction | 1.632 |
| InChIKey | HOPMUCXYRNOABF-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2cc(Cl)c(Cl)c(Cl)c2Cl)c1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,3,4-tetrachloro-5-(2,3,5-trichlorophenyl)benzene |