2,2',3,3',4,4',6-Heptachlorobiphenyl
Modify Date: 2025-08-26 23:13:21
2,2',3,3',4,4',6-Heptachlorobiphenyl structure
|
Common Name | 2,2',3,3',4,4',6-Heptachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 52663-71-5 | Molecular Weight | 395.32300 | |
| Density | 1.658 g/cm3 | Boiling Point | 410.8ºC at 760 mmHg | |
| Molecular Formula | C12H3Cl7 | Melting Point | 117.5°C | |
| MSDS | N/A | Flash Point | 200.9ºC | |
| Name | 2,2',3,3',4,4',6-Heptachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.658 g/cm3 |
|---|---|
| Boiling Point | 410.8ºC at 760 mmHg |
| Melting Point | 117.5°C |
| Molecular Formula | C12H3Cl7 |
| Molecular Weight | 395.32300 |
| Flash Point | 200.9ºC |
| Exact Mass | 391.80500 |
| LogP | 7.92740 |
| Index of Refraction | 1.632 |
| InChIKey | TZMHVHLTPWKZCI-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2c(Cl)cc(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,3,5-tetrachloro-4-(2,3,4-trichlorophenyl)benzene |