N-[2-(diethylamino)ethyl]-2-(4-hydroxyphenoxy)acetamide structure
|
Common Name | N-[2-(diethylamino)ethyl]-2-(4-hydroxyphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 52662-27-8 | Molecular Weight | 266.33600 | |
| Density | 1.106g/cm3 | Boiling Point | 484.5ºC at 760 mmHg | |
| Molecular Formula | C14H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.8ºC | |
| Name | N-[2-(diethylamino)ethyl]-2-(4-hydroxyphenoxy)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 484.5ºC at 760 mmHg |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.33600 |
| Flash Point | 246.8ºC |
| Exact Mass | 266.16300 |
| PSA | 65.29000 |
| LogP | 2.06930 |
| Index of Refraction | 1.532 |
| InChIKey | BNVQHKZSDDMBAW-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)COc1ccc(O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[2-(diethylam... CAS#:52662-27-8 |
| Literature: Thuillie,G. Chimica Therapeutica, 1966 , vol. 1, p. 82 - 86 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-Diethylaminoethyl)-2-(p-hydroxyphenoxy)acetamide |
| Acetamide,N-(2-(diethylamino)ethyl)-2-(4-hydroxyphenoxy) |
| N-(2-Diethylaminoethyl)-2-(4-hydroxyphenoxy)acetamide |