1-(4-nitrophenyl)cyclopentane-1-carboxylic acid structure
|
Common Name | 1-(4-nitrophenyl)cyclopentane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 52648-77-8 | Molecular Weight | 235.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-nitrophenyl)cyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO4 |
|---|---|
| Molecular Weight | 235.23600 |
| Exact Mass | 235.08400 |
| PSA | 83.12000 |
| LogP | 3.01440 |
| InChIKey | QDCPXRWNBXWBPZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc([N+](=O)[O-])cc2)CCCC1 |
| HS Code | 2916399090 |
|---|
|
~88%
1-(4-nitropheny... CAS#:52648-77-8 |
| Literature: Strijckmans; Hunter; Dolle; Coulon; Loc'h; Maziere Journal of Labelled Compounds and Radiopharmaceuticals, 1996 , vol. 38, # 5 p. 471 - 481 |
|
~%
1-(4-nitropheny... CAS#:52648-77-8 |
| Literature: Illig, Carl R.; Ballentine, Shelley K.; Chen, Jinsheng; DesJarlais, Renee Louise; Meegalla, Sanath K.; Wall, Mark; Wilson, Kenneth Patent: US2007/249608 A1, 2007 ; Location in patent: Page/Page column 33 ; US 20070249608 A1 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-nitrophenyl)cyclopentane-1-carboxylicacid |