4-[2-(2-nitrophenyl)hydrazinyl]-4-oxobutanoic acid
Modify Date: 2025-11-22 09:52:58
![4-[2-(2-nitrophenyl)hydrazinyl]-4-oxobutanoic acid Structure](https://image.chemsrc.com/caspic/375/5262-88-4.png)
4-[2-(2-nitrophenyl)hydrazinyl]-4-oxobutanoic acid structure
|
Common Name | 4-[2-(2-nitrophenyl)hydrazinyl]-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5262-88-4 | Molecular Weight | 253.21100 | |
| Density | 1.482g/cm3 | Boiling Point | 436.9ºC at 760mmHg | |
| Molecular Formula | C10H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | 4-[2-(2-nitrophenyl)hydrazinyl]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 436.9ºC at 760mmHg |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21100 |
| Flash Point | 218ºC |
| Exact Mass | 253.07000 |
| PSA | 127.74000 |
| LogP | 2.33920 |
| Index of Refraction | 1.639 |
| InChIKey | SHPVJNLKZALSLT-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)NNc1ccccc1[N+](=O)[O-] |
|
~%
4-[2-(2-nitroph... CAS#:5262-88-4 |
| Literature: Raetz,R.; Bliss,A.D. Journal of Heterocyclic Chemistry, 1966 , vol. 3, p. 20 - 26 |
![3,9-dichloro-2,4,8,10-tetraoxa-3,9-diphospha-spiro[5.5]undecane 3,9-disulfide structure](https://image.chemsrc.com/caspic/353/5305-81-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HMS2563A08 |
| 4-(2-{2-nitrophenyl}hydrazino)-4-oxobutanoic acid |