N4-Bz-2'-OMe-rC structure
|
Common Name | N4-Bz-2'-OMe-rC | ||
|---|---|---|---|---|
| CAS Number | 52571-45-6 | Molecular Weight | 361.35 | |
| Density | 1.49g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H19N3O6 | Melting Point | 174-175ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of N4-Bz-2'-OMe-rCN4-Benzoyl-2’-O-methylcytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
| Name | N4-Benzoyl-2'-O-methylcytidine |
|---|---|
| Synonym | More Synonyms |
| Description | N4-Benzoyl-2’-O-methylcytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.49g/cm3 |
|---|---|
| Melting Point | 174-175ºC |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 |
| Exact Mass | 361.12700 |
| PSA | 122.91000 |
| Appearance of Characters | Powder | White to Pale Yellow |
| Index of Refraction | 1.659 |
| InChIKey | LIZIIHWLABYQKD-XKVFNRALSA-N |
| SMILES | COC1C(O)C(CO)OC1n1ccc(NC(=O)c2ccccc2)nc1=O |
| Hazard Codes | Xi |
|---|
| N-[1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| N4-Bz-2'-OMe-rC |