sodium,4-(5-phenyl-3,4-dihydropyrazol-2-yl)benzoate structure
|
Common Name | sodium,4-(5-phenyl-3,4-dihydropyrazol-2-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 5252-93-7 | Molecular Weight | 288.27600 | |
| Density | N/A | Boiling Point | 470.2ºC at 760 mmHg | |
| Molecular Formula | C16H13N2NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.2ºC | |
| Name | sodium,4-(5-phenyl-3,4-dihydropyrazol-2-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 470.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H13N2NaO2 |
| Molecular Weight | 288.27600 |
| Flash Point | 238.2ºC |
| Exact Mass | 288.08700 |
| PSA | 55.73000 |
| LogP | 1.16510 |
| InChIKey | FWAMGCNSPQRQEQ-UHFFFAOYSA-M |
| SMILES | O=C([O-])c1ccc(N2CCC(c3ccccc3)=N2)cc1.[Na+] |
|
~%
sodium,4-(5-phe... CAS#:5252-93-7 |
| Literature: Krapcho; Turk Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 809 - 812 |
|
~%
sodium,4-(5-phe... CAS#:5252-93-7 |
| Literature: Krapcho; Turk Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 809 - 812 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,2-[(1-oxo-3-phenyl-2-propen-1-yl)amino]-,2-(dimethylamino)ethyl ester |
| SODIUM 4-(3-PHENYL-4,5-DIHYDROPYRAZOL-1-YL)BENZOATE |
| Anthranilicacid,N-cinnamoyl-,2-(dimethylamino)ethyl ester (7CI,8CI) |
| sodium 4-(5-phenyl-3,4-dihydropyrazol-2-yl)benzoate |