methyl-(2-oxo-1,2-diphenylethyl)azanium,chloride
Modify Date: 2025-09-29 13:05:37
methyl-(2-oxo-1,2-diphenylethyl)azanium,chloride structure
|
Common Name | methyl-(2-oxo-1,2-diphenylethyl)azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 52514-77-9 | Molecular Weight | 261.74700 | |
| Density | N/A | Boiling Point | 355.4ºC at 760 mmHg | |
| Molecular Formula | C15H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134ºC | |
| Name | methyl-(2-oxo-1,2-diphenylethyl)azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 355.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.74700 |
| Flash Point | 134ºC |
| Exact Mass | 261.09200 |
| PSA | 29.10000 |
| LogP | 4.02290 |
| InChIKey | JNSVLLHYPIVQBA-UHFFFAOYSA-N |
| SMILES | C[NH2+]C(C(=O)c1ccccc1)c1ccccc1.[Cl-] |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethanone,2-(methylamino)-1,2-diphenyl-,hydrochloride |
| ACETOPHENONE,2-METHYLAMINO-2-PHENYL-,HYDROCHLORIDE |
| methyl-(2-oxo-1,2-diphenylethyl)azanium chloride |
| 2-Methylamino-2-phenylacetophenone hydrochloride |
| N-methyl-2-oxo-1,2-diphenylethanaminium chloride |