dimethylaminoethyl acetylsalicylate
Modify Date: 2025-12-02 00:38:52
dimethylaminoethyl acetylsalicylate structure
|
Common Name | dimethylaminoethyl acetylsalicylate | ||
|---|---|---|---|---|
| CAS Number | 52461-48-0 | Molecular Weight | 251.27800 | |
| Density | 1.133g/cm3 | Boiling Point | 329.9ºC at 760mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3ºC | |
| Name | 2-(dimethylamino)ethyl 2-acetyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 329.9ºC at 760mmHg |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.27800 |
| Flash Point | 153.3ºC |
| Exact Mass | 251.11600 |
| PSA | 55.84000 |
| LogP | 1.33030 |
| Index of Refraction | 1.516 |
| InChIKey | SWNNLZURDOQIQO-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCCN(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dimethylaminoethanolacetylsalicylate |
| Dimethylaminoethyl acetylsalicylate |
| Benzoic acid,2-(acetyloxy)-,2-(dimethylamino)ethyl ester |