ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxocyclopentane-1-carboxylate structure
|
Common Name | ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxocyclopentane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5239-91-8 | Molecular Weight | 312.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxocyclopentane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H28O5 |
|---|---|
| Molecular Weight | 312.40100 |
| Exact Mass | 312.19400 |
| PSA | 69.67000 |
| LogP | 3.19260 |
| InChIKey | JJFBQYBFBRTIEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCC1(C(=O)OCC)CCCC1=O |
| HS Code | 2918990090 |
|---|
|
~%
ethyl 1-(7-etho... CAS#:5239-91-8 |
| Literature: PHARMAGENE LABORATORIES LIMITED Patent: WO2005/61449 A1, 2005 ; Location in patent: Page/Page column 47 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopentaneheptanoic acid,1-(ethoxycarbonyl)-2-oxo-,ethyl ester |