1-Triazene,3,3-dimethyl-1-(2,4,6-trimethylphenyl)- structure
|
Common Name | 1-Triazene,3,3-dimethyl-1-(2,4,6-trimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 52389-03-4 | Molecular Weight | 191.27300 | |
| Density | 0.97g/cm3 | Boiling Point | 288ºC at 760 mmHg | |
| Molecular Formula | C11H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128ºC | |
| Name | N-methyl-N-[(2,4,6-trimethylphenyl)diazenyl]methanamine |
|---|
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 288ºC at 760 mmHg |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.27300 |
| Flash Point | 128ºC |
| Exact Mass | 191.14200 |
| PSA | 27.96000 |
| LogP | 3.17210 |
| Index of Refraction | 1.519 |
| InChIKey | DLLZWQCBOQDMMO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(N=NN(C)C)c(C)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |