ethyl 1-methyl-3-phenylpiperidine-3-carboxylate
Modify Date: 2025-09-19 18:08:56
ethyl 1-methyl-3-phenylpiperidine-3-carboxylate structure
|
Common Name | ethyl 1-methyl-3-phenylpiperidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 52370-94-2 | Molecular Weight | 247.33300 | |
| Density | 1.055g/cm3 | Boiling Point | 331ºC at 760 mmHg | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.7ºC | |
| Name | ethyl 1-methyl-3-phenylpiperidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 331ºC at 760 mmHg |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.33300 |
| Flash Point | 112.7ºC |
| Exact Mass | 247.15700 |
| PSA | 29.54000 |
| LogP | 2.15100 |
| Index of Refraction | 1.52 |
| InChIKey | KYWYUHIJUSFICD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(c2ccccc2)CCCN(C)C1 |
| HS Code | 2933399090 |
|---|
|
~%
ethyl 1-methyl-... CAS#:52370-94-2 |
| Literature: Avison; Morrison Journal of the Chemical Society, 1950 , p. 1474,1476 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nipecotic acid,1-methyl-3-phenyl-,ethyl esters (5CI) |
| EINECS 257-882-7 |
| Isopethidine |
| Nipecotic acid,1-methyl-3-phenyl-,ethyl ester (6CI) |
| Methadin |
| 3-Piperidinecarboxylicacid,1-methyl-3-phenyl-,ethyl ester |