3-[2-(2-Butoxyethoxy)ethoxyiminomethyl]rifamycin SV
Modify Date: 2025-09-04 11:17:55
![3-[2-(2-Butoxyethoxy)ethoxyiminomethyl]rifamycin SV Structure](https://image.chemsrc.com/caspic/496/52370-32-8.png)
3-[2-(2-Butoxyethoxy)ethoxyiminomethyl]rifamycin SV structure
|
Common Name | 3-[2-(2-Butoxyethoxy)ethoxyiminomethyl]rifamycin SV | ||
|---|---|---|---|---|
| CAS Number | 52370-32-8 | Molecular Weight | 885.00500 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C46H64N2O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | brn 5418838 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C46H64N2O15 |
| Molecular Weight | 885.00500 |
| Exact Mass | 884.43100 |
| PSA | 241.36000 |
| LogP | 5.69550 |
| Index of Refraction | 1.59 |
| InChIKey | LSYKXUPTBOISHA-QEIILYRFSA-N |
| SMILES | CCCCOCCOCCON=Cc1c2c(O)c3c(O)c(C)c4c(c3c1O)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
3-[2-(2-Butoxye... CAS#:52370-32-8 |
| Literature: Cricchio; Lancini; Tamborini; Sensi Journal of Medicinal Chemistry, 1974 , vol. 17, # 4 p. 396 - 403 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,7-(Epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-1,11(2H)-dione,3-formyl-5,6,9,17,19,21-hexahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-,21-acetate,O-(2-(2-butoxyethoxy)ethyl)oxime |
| 3-Formylrifamycin SV O-(2-(butoxyethoxy)ethyl)oxime |