methyl (E)-4-tert-butylperoxy-4-oxobut-2-enoate
Modify Date: 2024-04-02 16:01:32
methyl (E)-4-tert-butylperoxy-4-oxobut-2-enoate structure
|
Common Name | methyl (E)-4-tert-butylperoxy-4-oxobut-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 52345-49-0 | Molecular Weight | 202.20400 | |
| Density | 1.098g/cm3 | Boiling Point | 232.3ºC at 760 mmHg | |
| Molecular Formula | C9H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.8ºC | |
| Name | methyl (E)-4-tert-butylperoxy-4-oxobut-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 232.3ºC at 760 mmHg |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.20400 |
| Flash Point | 92.8ºC |
| Exact Mass | 202.08400 |
| PSA | 61.83000 |
| LogP | 0.98890 |
| Index of Refraction | 1.445 |
| InChIKey | WVSJZOKBOUVTBA-AATRIKPKSA-N |
| SMILES | COC(=O)C=CC(=O)OOC(C)(C)C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Oo-tert-butyl o-methylperfumarate |
| O-tert-butyl o-methylperfumarate |