1-diazonio-4-(4-methylphenyl)but-1-en-2-olate structure
|
Common Name | 1-diazonio-4-(4-methylphenyl)but-1-en-2-olate | ||
|---|---|---|---|---|
| CAS Number | 52345-23-0 | Molecular Weight | 188.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-diazonio-4-(4-methylphenyl)but-1-en-2-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12N2O |
|---|---|
| Molecular Weight | 188.22600 |
| Exact Mass | 188.09500 |
| PSA | 54.46000 |
| LogP | 1.87836 |
| InChIKey | GKASDWXUKVNXBM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CCC(=O)C=[N+]=[N-])cc1 |
|
~%
1-diazonio-4-(4... CAS#:52345-23-0 |
| Literature: Kennedy, Michael; McKervey, M. Anthony; Maguire, Anita R.; Tuladhar, Sarbajna M.; Twohig, M. Fiona Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , # 4 p. 1047 - 1054 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Butanone,1-diazo-4-(4-methylphenyl) |