1-bromo-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene structure
|
Common Name | 1-bromo-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 52328-77-5 | Molecular Weight | 323.03000 | |
| Density | 1.65g/cm3 | Boiling Point | 211.605ºC at 760 mmHg | |
| Molecular Formula | C9H5BrF6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.26ºC | |
| Name | 1-bromo-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 211.605ºC at 760 mmHg |
| Molecular Formula | C9H5BrF6O |
| Molecular Weight | 323.03000 |
| Flash Point | 104.26ºC |
| Exact Mass | 321.94300 |
| PSA | 9.23000 |
| LogP | 4.32110 |
| Index of Refraction | 1.432 |
| InChIKey | LDNCBJYYWUBTQA-UHFFFAOYSA-N |
| SMILES | FC(C(F)(F)F)C(F)(F)Oc1ccccc1Br |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| PC6678 |
| 2-(2H-Perfluoropropoxy)bromobenzene |