Furo[2,3-b]quinolin-4 (9H)-one, 6,7-dimethoxy-9-methyl-
Modify Date: 2025-09-15 18:46:48
![Furo[2,3-b]quinolin-4 (9H)-one, 6,7-dimethoxy-9-methyl- Structure](https://image.chemsrc.com/caspic/123/523-15-9.png)
Furo[2,3-b]quinolin-4 (9H)-one, 6,7-dimethoxy-9-methyl- structure
|
Common Name | Furo[2,3-b]quinolin-4 (9H)-one, 6,7-dimethoxy-9-methyl- | ||
|---|---|---|---|---|
| CAS Number | 523-15-9 | Molecular Weight | 259.25700 | |
| Density | 1.268g/cm3 | Boiling Point | 434.3ºC at 760 mmHg | |
| Molecular Formula | C14H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.4ºC | |
| Name | 6,7-dimethoxy-9-methylfuro[2,3-b]quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 434.3ºC at 760 mmHg |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.25700 |
| Flash Point | 216.4ºC |
| Exact Mass | 259.08400 |
| PSA | 53.60000 |
| LogP | 2.30190 |
| Index of Refraction | 1.578 |
| InChIKey | LOHVXKBBNRJOBJ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(=O)c3ccoc3n(C)c2cc1OC |
| HS Code | 2934999090 |
|---|
|
~%
Furo[2,3-b]quin... CAS#:523-15-9 |
| Literature: Gell et al. Australian Journal of Chemistry, 1955 , vol. 8, p. 114,117 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-dimethoxy-9-methylfuro[2,3-b]quinolin-4(9h)-one |
| Isokokusaginine |
| Furo[2,6,7-dimethoxy-9-methyl |
| Isokokusaginin |