1,2-bis(ethenyl)benzene,4-butoxy-4-oxobut-2-enoic acid,styrene structure
|
Common Name | 1,2-bis(ethenyl)benzene,4-butoxy-4-oxobut-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 52292-42-9 | Molecular Weight | 406.51400 | |
| Density | N/A | Boiling Point | 289.1ºC at 760mmHg | |
| Molecular Formula | C26H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.9ºC | |
| Name | 1,2-bis(ethenyl)benzene,4-butoxy-4-oxobut-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 289.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.51400 |
| Flash Point | 113.9ºC |
| Exact Mass | 406.21400 |
| PSA | 63.60000 |
| LogP | 6.27270 |
| InChIKey | SBKPQTFZWFXVRB-FXHNQCOHSA-N |
| SMILES | C=Cc1ccccc1.C=Cc1ccccc1C=C.CCCCOC(=O)C=CC(=O)O |
| (Z)-4-butoxy-4-oxo-but-2-enoic acid |
| 2-Butenedioic acid(Z)-,monobutylester,polymer with diethenylbenzene and ethenylbenzene |