2-(3-Hydroxy-2-quinolyl)-1,3-dioxoindane-5-carbonyl chloride
Modify Date: 2025-08-21 14:57:09
2-(3-Hydroxy-2-quinolyl)-1,3-dioxoindane-5-carbonyl chloride structure
|
Common Name | 2-(3-Hydroxy-2-quinolyl)-1,3-dioxoindane-5-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 52237-05-5 | Molecular Weight | 351.74000 | |
| Density | 1.543g/cm3 | Boiling Point | 590.7ºC at 760 mmHg | |
| Molecular Formula | C19H10ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311ºC | |
| Name | 2-(3-hydroxyquinolin-2-yl)-1,3-dioxoindene-5-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.543g/cm3 |
|---|---|
| Boiling Point | 590.7ºC at 760 mmHg |
| Molecular Formula | C19H10ClNO4 |
| Molecular Weight | 351.74000 |
| Flash Point | 311ºC |
| Exact Mass | 351.03000 |
| PSA | 84.33000 |
| LogP | 3.48220 |
| Index of Refraction | 1.732 |
| InChIKey | PQVLFZPMTPSKDA-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc2c(c1)C(=O)C(c1nc3ccccc3cc1O)C2=O |
| HS Code | 2933499090 |
|---|
|
~%
2-(3-Hydroxy-2-... CAS#:52237-05-5 |
| Literature: Imazeki, Shuji; Mukoh, Akio; Yoneyama, Tomio; Kaneko, Masaharu Molecular Crystals and Liquid Crystals (1969-1991), 1987 , vol. 145, p. 79 - 94 |
|
~%
2-(3-Hydroxy-2-... CAS#:52237-05-5 |
| Literature: Imazeki, Shuji; Mukoh, Akio; Yoneyama, Tomio; Kaneko, Masaharu Molecular Crystals and Liquid Crystals (1969-1991), 1987 , vol. 145, p. 79 - 94 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-hydroxyquinolin-2-yl)-1,3-dioxo-indene-5-carbonyl chloride |
| 1H-Indene-5-carbonyl chloride,2,3-dihydro-2-(3-hydroxy-2-quinolinyl)-1,3-dioxo |
| 2-(3-hydroxyquinolin-2-yl)-1,3-dioxoindane-5-carbonyl chloride |