diethyl 2-methylcyclohexane-1,1-dicarboxylate structure
|
Common Name | diethyl 2-methylcyclohexane-1,1-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 5222-56-0 | Molecular Weight | 242.31100 | |
| Density | 1.039g/cm3 | Boiling Point | 278.5ºC at 760 mmHg | |
| Molecular Formula | C13H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-methylcyclohexane-1,1-dicarboxylate |
|---|
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 278.5ºC at 760 mmHg |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31100 |
| Exact Mass | 242.15200 |
| PSA | 52.60000 |
| LogP | 2.30910 |
| Index of Refraction | 1.456 |
| InChIKey | MGCXPTONXMVEMP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCCC1C |
| HS Code | 2917209090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |